C22H35BrN2O2 — CID 54165649
N-[3-[3-(azepan-2-ylmethyl)phenoxy]propyl]-6-bromohexanamide (PubChem CID 54165649) has the molecular formula C22H35BrN2O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is N-[3-[3-(azepan-2-ylmethyl)phenoxy]propyl]-6-bromohexanamide.
| Compound Name | N-[3-[3-(azepan-2-ylmethyl)phenoxy]propyl]-6-bromohexanamide |
|---|---|
| PubChem CID | 54165649 |
| Molecular Formula | C22H35BrN2O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | N-[3-[3-(azepan-2-ylmethyl)phenoxy]propyl]-6-bromohexanamide |
| SMILES | O=C(CCCCCBr)NCCCOc1cccc(CC2CCCCCN2)c1 |
| InChI | InChI=1S/C22H35BrN2O2/c23-13-5-1-4-12-22(26)25-15-8-16-27-21-11-7-9-19(18-21)17-20-10-3-2-6-14-24-20/h7,9,11,18,20,24H,1-6,8,10,12-17H2,(H,25,26) |
| InChIKey | ORLYIXNNLXPXCX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|