C33H41NO5 — CID 54166129
4,5-dipentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindole-1,3-diol (PubChem CID 54166129) has the molecular formula C33H41NO5 and a molecular weight of 531.69 g/mol. Its IUPAC name is 4,5-dipentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindole-1,3-diol.
| Compound Name | 4,5-dipentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindole-1,3-diol |
|---|---|
| PubChem CID | 54166129 |
| Molecular Formula | C33H41NO5 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 4,5-dipentoxy-2-[2-(4-phenylmethoxyphenyl)ethyl]isoindole-1,3-diol |
| SMILES | CCCCCOc1ccc2c(O)n(CCc3ccc(OCc4ccccc4)cc3)c(O)c2c1OCCCCC |
| InChI | InChI=1S/C33H41NO5/c1-3-5-10-22-37-29-19-18-28-30(31(29)38-23-11-6-4-2)33(36)34(32(28)35)21-20-25-14-16-27(17-15-25)39-24-26-12-8-7-9-13-26/h7-9,12-19,35-36H,3-6,10-11,20-24H2,1-2H3 |
| InChIKey | ORTLXYOEPXYOAV-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 73.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|