C24H26FNO4 — CID 57220806
2-ethyl-9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydrobenzo[e]isoindole-1,3-diol (PubChem CID 57220806) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-ethyl-9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydrobenzo[e]isoindole-1,3-diol.
| Compound Name | 2-ethyl-9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydrobenzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 57220806 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-ethyl-9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydrobenzo[e]isoindole-1,3-diol |
| SMILES | CCn1c(O)c2c(c1O)-c1c(OCCCc3ccc(F)cc3)ccc(OC)c1CC2 |
| InChI | InChI=1S/C24H26FNO4/c1-3-26-23(27)18-11-10-17-19(29-2)12-13-20(21(17)22(18)24(26)28)30-14-4-5-15-6-8-16(25)9-7-15/h6-9,12-13,27-28H,3-5,10-11,14H2,1-2H3 |
| InChIKey | BJOIRUBXEBGJOI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|