C22H22FNO4 — CID 56987660
9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol (PubChem CID 56987660) has the molecular formula C22H22FNO4 and a molecular weight of 383.42 g/mol. Its IUPAC name is 9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol.
| Compound Name | 9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 56987660 |
| Molecular Formula | C22H22FNO4 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 9-[3-(4-fluorophenyl)propoxy]-6-methoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol |
| SMILES | COc1ccc(OCCCc2ccc(F)cc2)c2c1CCc1c(O)[nH]c(O)c1-2 |
| InChI | InChI=1S/C22H22FNO4/c1-27-17-10-11-18(28-12-2-3-13-4-6-14(23)7-5-13)19-15(17)8-9-16-20(19)22(26)24-21(16)25/h4-7,10-11,24-26H,2-3,8-9,12H2,1H3 |
| InChIKey | MXBGDJIEZHCJHW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|