C14H15NO4 — CID 54126382
6,7-dimethoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol (PubChem CID 54126382) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6,7-dimethoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol.
| Compound Name | 6,7-dimethoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol |
|---|---|
| PubChem CID | 54126382 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6,7-dimethoxy-4,5-dihydro-2H-benzo[e]isoindole-1,3-diol |
| SMILES | COc1ccc2c(c1OC)CCc1c(O)[nH]c(O)c1-2 |
| InChI | InChI=1S/C14H15NO4/c1-18-10-6-5-7-8(12(10)19-2)3-4-9-11(7)14(17)15-13(9)16/h5-6,15-17H,3-4H2,1-2H3 |
| InChIKey | NRGFJFJRRDDWTM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |