C12H9NO3 — CID 54061447
2H-[1]benzoxepino[4,5-c]pyrrole-1,3-diol (PubChem CID 54061447) has the molecular formula C12H9NO3 and a molecular weight of 215.21 g/mol. Its IUPAC name is 2H-[1]benzoxepino[4,5-c]pyrrole-1,3-diol.
| Compound Name | 2H-[1]benzoxepino[4,5-c]pyrrole-1,3-diol |
|---|---|
| PubChem CID | 54061447 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2H-[1]benzoxepino[4,5-c]pyrrole-1,3-diol |
| SMILES | Oc1[nH]c(O)c2c1C=COc1ccccc1-2 |
| InChI | InChI=1S/C12H9NO3/c14-11-8-5-6-16-9-4-2-1-3-7(9)10(8)12(15)13-11/h1-6,13-15H |
| InChIKey | LZZWCHZQPZUAOJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |