C14H13NO3 — CID 54423769
4-(2-hydroxyphenyl)-4,5-dihydro-2H-isoindole-1,3-diol (PubChem CID 54423769) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-4,5-dihydro-2H-isoindole-1,3-diol.
| Compound Name | 4-(2-hydroxyphenyl)-4,5-dihydro-2H-isoindole-1,3-diol |
|---|---|
| PubChem CID | 54423769 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-(2-hydroxyphenyl)-4,5-dihydro-2H-isoindole-1,3-diol |
| SMILES | Oc1ccccc1C1CC=Cc2c(O)[nH]c(O)c21 |
| InChI | InChI=1S/C14H13NO3/c16-11-7-2-1-4-8(11)9-5-3-6-10-12(9)14(18)15-13(10)17/h1-4,6-7,9,15-18H,5H2 |
| InChIKey | WCPUWCKITPHGPM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |