C11H9NO3 — CID 54274363
2,4-dihydrochromeno[3,4-c]pyrrole-1,3-diol (PubChem CID 54274363) has the molecular formula C11H9NO3 and a molecular weight of 203.20 g/mol. Its IUPAC name is 2,4-dihydrochromeno[3,4-c]pyrrole-1,3-diol.
| Compound Name | 2,4-dihydrochromeno[3,4-c]pyrrole-1,3-diol |
|---|---|
| PubChem CID | 54274363 |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | 2,4-dihydrochromeno[3,4-c]pyrrole-1,3-diol |
| SMILES | Oc1[nH]c(O)c2c1COc1ccccc1-2 |
| InChI | InChI=1S/C11H9NO3/c13-10-7-5-15-8-4-2-1-3-6(8)9(7)11(14)12-10/h1-4,12-14H,5H2 |
| InChIKey | RMJKAFZVXAHEGV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |