C14H9NO2 — CID 91057853
8-oxa-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ol (PubChem CID 91057853) has the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. Its IUPAC name is 8-oxa-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ol.
| Compound Name | 8-oxa-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ol |
|---|---|
| PubChem CID | 91057853 |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 8-oxa-15-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-14-ol |
| SMILES | Oc1[nH]c2c3c(cccc13)Oc1ccccc1-2 |
| InChI | InChI=1S/C14H9NO2/c16-14-9-5-3-7-11-12(9)13(15-14)8-4-1-2-6-10(8)17-11/h1-7,15-16H |
| InChIKey | NDUDTCYJMDPTFL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |