C15H28N4O4S — CID 541673
ethyl 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]ethanimidothioate (PubChem CID 541673) has the molecular formula C15H28N4O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]ethanimidothioate.
| Compound Name | ethyl 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]ethanimidothioate |
|---|---|
| PubChem CID | 541673 |
| Molecular Formula | C15H28N4O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl 2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylamino]propanoylamino]ethanimidothioate |
| SMILES | [H]/N=C(/CNC(=O)C(C)NC(=O)C(C)NC(=O)OC(C)(C)C)SCC |
| InChI | InChI=1S/C15H28N4O4S/c1-7-24-11(16)8-17-12(20)9(2)18-13(21)10(3)19-14(22)23-15(4,5)6/h9-10,16H,7-8H2,1-6H3,(H,17,20)(H,18,21)(H,19,22)/b16-11- |
| InChIKey | OSARAAMHMGIPPP-WJDWOHSUSA-N |
| XLogP | 1.25 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|