About acetaldehyde;1-methyliminopropan-2-one
acetaldehyde;1-methyliminopropan-2-one (PubChem CID 54167476) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is acetaldehyde;1-methyliminopropan-2-one.
Molecular Properties
| Compound Name | acetaldehyde;1-methyliminopropan-2-one |
| PubChem CID | 54167476 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | acetaldehyde;1-methyliminopropan-2-one |
| SMILES | C/N=C/C(C)=O.CC=O |
| InChI | InChI=1S/C4H7NO.C2H4O/c1-4(6)3-5-2;1-2-3/h3H,1-2H3;2H,1H3/b5-3+; |
| InChIKey | OSRBOZLNLFELDE-WGCWOXMQSA-N |
| XLogP | 0.48 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;1-methyliminopropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;1-methyliminopropan-2-one?
The IUPAC name of acetaldehyde;1-methyliminopropan-2-one (CID 54167476) is acetaldehyde;1-methyliminopropan-2-one.
What is the SMILES notation for acetaldehyde;1-methyliminopropan-2-one?
The canonical SMILES for acetaldehyde;1-methyliminopropan-2-one is C/N=C/C(C)=O.CC=O.
What is the InChIKey of acetaldehyde;1-methyliminopropan-2-one?
The InChIKey is OSRBOZLNLFELDE-WGCWOXMQSA-N. The full InChI is InChI=1S/C4H7NO.C2H4O/c1-4(6)3-5-2;1-2-3/h3H,1-2H3;2H,1H3/b5-3+;.
What are the key properties of acetaldehyde;1-methyliminopropan-2-one?
acetaldehyde;1-methyliminopropan-2-one has a molecular weight of 129.16 g/mol, XLogP of 0.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;1-methyliminopropan-2-one is sourced from PubChem (CID 54167476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).