C16H26O2S2 — CID 54169768
2,2-dimethyl-3-(4-pentylphenyl)sulfonylpropane-1-thiol (PubChem CID 54169768) has the molecular formula C16H26O2S2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-pentylphenyl)sulfonylpropane-1-thiol.
| Compound Name | 2,2-dimethyl-3-(4-pentylphenyl)sulfonylpropane-1-thiol |
|---|---|
| PubChem CID | 54169768 |
| Molecular Formula | C16H26O2S2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2,2-dimethyl-3-(4-pentylphenyl)sulfonylpropane-1-thiol |
| SMILES | CCCCCc1ccc(S(=O)(=O)CC(C)(C)CS)cc1 |
| InChI | InChI=1S/C16H26O2S2/c1-4-5-6-7-14-8-10-15(11-9-14)20(17,18)13-16(2,3)12-19/h8-11,19H,4-7,12-13H2,1-3H3 |
| InChIKey | OUEPZXMEHCZXCX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|