C18H14F4N2O3 — CID 54170078
ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,4,5-trifluoro-3-methylphenyl)propanoate (PubChem CID 54170078) has the molecular formula C18H14F4N2O3 and a molecular weight of 382.31 g/mol. Its IUPAC name is ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,4,5-trifluoro-3-methylphenyl)propanoate.
| Compound Name | ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,4,5-trifluoro-3-methylphenyl)propanoate |
|---|---|
| PubChem CID | 54170078 |
| Molecular Formula | C18H14F4N2O3 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | ethyl 2-[(5-fluoro-2-pyridinyl)iminomethyl]-3-oxo-3-(2,4,5-trifluoro-3-methylphenyl)propanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(F)cn1)C(=O)c1cc(F)c(F)c(C)c1F |
| InChI | InChI=1S/C18H14F4N2O3/c1-3-27-18(26)12(8-24-14-5-4-10(19)7-23-14)17(25)11-6-13(20)16(22)9(2)15(11)21/h4-8,12H,3H2,1-2H3/b24-8+ |
| InChIKey | OUJSBBZCXFJCTC-KTZMUZOWSA-N |
| XLogP | 3.71 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|