C28H33F2NO3S — CID 54170115
O-butyl 1-(3,3-dimethyl-2-oxopentanoyl)-4,4-bis(4-fluorophenyl)pyrrolidine-2-carbothioate (PubChem CID 54170115) has the molecular formula C28H33F2NO3S and a molecular weight of 501.64 g/mol. Its IUPAC name is O-butyl 1-(3,3-dimethyl-2-oxopentanoyl)-4,4-bis(4-fluorophenyl)pyrrolidine-2-carbothioate.
| Compound Name | O-butyl 1-(3,3-dimethyl-2-oxopentanoyl)-4,4-bis(4-fluorophenyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 54170115 |
| Molecular Formula | C28H33F2NO3S |
| Molecular Weight | 501.64 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | O-butyl 1-(3,3-dimethyl-2-oxopentanoyl)-4,4-bis(4-fluorophenyl)pyrrolidine-2-carbothioate |
| SMILES | CCCCOC(=S)C1CC(c2ccc(F)cc2)(c2ccc(F)cc2)CN1C(=O)C(=O)C(C)(C)CC |
| InChI | InChI=1S/C28H33F2NO3S/c1-5-7-16-34-26(35)23-17-28(19-8-12-21(29)13-9-19,20-10-14-22(30)15-11-20)18-31(23)25(33)24(32)27(3,4)6-2/h8-15,23H,5-7,16-18H2,1-4H3 |
| InChIKey | OUKLFTXDPJMPKP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|