C28H43N5O4S — CID 54171180
N'-[(2-amino-1,3-thiazol-4-yl)methyl]-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-(pyridin-2-ylmethyl)butanediamide (PubChem CID 54171180) has the molecular formula C28H43N5O4S and a molecular weight of 545.75 g/mol. Its IUPAC name is N'-[(2-amino-1,3-thiazol-4-yl)methyl]-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-(pyridin-2-ylmethyl)butanediamide.
| Compound Name | N'-[(2-amino-1,3-thiazol-4-yl)methyl]-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-(pyridin-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 54171180 |
| Molecular Formula | C28H43N5O4S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | N'-[(2-amino-1,3-thiazol-4-yl)methyl]-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-(pyridin-2-ylmethyl)butanediamide |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)N(Cc1csc(N)n1)C(=O)CCC(=O)NCc1ccccn1 |
| InChI | InChI=1S/C28H43N5O4S/c1-19(2)14-24(34)27(37)23(15-20-8-4-3-5-9-20)33(17-22-18-38-28(29)32-22)26(36)12-11-25(35)31-16-21-10-6-7-13-30-21/h6-7,10,13,18-20,23-24,27,34,37H,3-5,8-9,11-12,14-17H2,1-2H3,(H2,29,32)(H,31,35)/t23-,24-,27+/m0/s1 |
| InChIKey | OVDJDFJCLAZFPS-NLJOTIRTSA-N |
| XLogP | 3.65 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |