C39H55N5O5S — CID 54188073
N-benzyl-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]-N'-(1,3-thiazol-2-ylmethyl)butanediamide (PubChem CID 54188073) has the molecular formula C39H55N5O5S and a molecular weight of 705.97 g/mol. Its IUPAC name is N-benzyl-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]-N'-(1,3-thiazol-2-ylmethyl)butanediamide.
| Compound Name | N-benzyl-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]-N'-(1,3-thiazol-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 54188073 |
| Molecular Formula | C39H55N5O5S |
| Molecular Weight | 705.97 g/mol |
| Exact Mass | 705.39 |
| IUPAC Name | N-benzyl-N'-[(2S,3R,4S)-1-cyclohexyl-3,4-dihydroxy-6-methylheptan-2-yl]-N-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]-N'-(1,3-thiazol-2-ylmethyl)butanediamide |
| SMILES | CC(C)C[C@H](O)[C@H](O)[C@H](CC1CCCCC1)N(Cc1nccs1)C(=O)CCC(=O)N(CC(=O)N(C)CCc1ccccn1)Cc1ccccc1 |
| InChI | InChI=1S/C39H55N5O5S/c1-29(2)24-34(45)39(49)33(25-30-12-6-4-7-13-30)44(27-35-41-21-23-50-35)37(47)18-17-36(46)43(26-31-14-8-5-9-15-31)28-38(48)42(3)22-19-32-16-10-11-20-40-32/h5,8-11,14-16,20-21,23,29-30,33-34,39,45,49H,4,6-7,12-13,17-19,22,24-28H2,1-3H3/t33-,34-,39+/m0/s1 |
| InChIKey | PGNJOZSFNLYSOC-XWCRKRNLSA-N |
| XLogP | 5.48 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.97 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |