C18H16Cl2F2N4 — CID 54175778
[7-chloro-5-(2,6-difluorophenyl)-2,3-dihydro-1,4-benzodiazepin-1-yl]-(1-chloropropan-2-yl)diazene (PubChem CID 54175778) has the molecular formula C18H16Cl2F2N4 and a molecular weight of 397.26 g/mol. Its IUPAC name is [7-chloro-5-(2,6-difluorophenyl)-2,3-dihydro-1,4-benzodiazepin-1-yl]-(1-chloropropan-2-yl)diazene.
| Compound Name | [7-chloro-5-(2,6-difluorophenyl)-2,3-dihydro-1,4-benzodiazepin-1-yl]-(1-chloropropan-2-yl)diazene |
|---|---|
| PubChem CID | 54175778 |
| Molecular Formula | C18H16Cl2F2N4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | [7-chloro-5-(2,6-difluorophenyl)-2,3-dihydro-1,4-benzodiazepin-1-yl]-(1-chloropropan-2-yl)diazene |
| SMILES | CC(CCl)/N=N/N1CCN=C(c2c(F)cccc2F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H16Cl2F2N4/c1-11(10-19)24-25-26-8-7-23-18(13-9-12(20)5-6-16(13)26)17-14(21)3-2-4-15(17)22/h2-6,9,11H,7-8,10H2,1H3/b25-24+ |
| InChIKey | OYGAEQPSSWKRLJ-OCOZRVBESA-N |
| XLogP | 5.27 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|