C41H60N2O6 — CID 54176270
(4S,5R)-5-(cyclohexylmethyl)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-9,9-dimethyl-N-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-7-oxodecanamide (PubChem CID 54176270) has the molecular formula C41H60N2O6 and a molecular weight of 676.94 g/mol. Its IUPAC name is (4S,5R)-5-(cyclohexylmethyl)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-9,9-dimethyl-N-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-7-oxodecanamide.
| Compound Name | (4S,5R)-5-(cyclohexylmethyl)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-9,9-dimethyl-N-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-7-oxodecanamide |
|---|---|
| PubChem CID | 54176270 |
| Molecular Formula | C41H60N2O6 |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.45 |
| IUPAC Name | (4S,5R)-5-(cyclohexylmethyl)-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3-dihydro-1H-inden-1-yl]-9,9-dimethyl-N-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-7-oxodecanamide |
| SMILES | CC(C)(C)CC(=O)C[C@@H](CC1CCCCC1)[C@@H](O)CCC(=O)N(Cc1ccc(OCCN2CCOCC2)cc1)[C@H]1c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C41H60N2O6/c1-41(2,3)28-34(44)26-33(25-30-9-5-4-6-10-30)37(45)17-18-39(47)43(40-36-12-8-7-11-32(36)27-38(40)46)29-31-13-15-35(16-14-31)49-24-21-42-19-22-48-23-20-42/h7-8,11-16,30,33,37-38,40,45-46H,4-6,9-10,17-29H2,1-3H3/t33-,37+,38-,40+/m1/s1 |
| InChIKey | OYORTINHUXVWAH-MTZNQXOKSA-N |
| XLogP | 6.51 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |