C13H18N4O3 — CID 54178618
9-N,9-N,6-trimethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3,9-dicarboxamide (PubChem CID 54178618) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 9-N,9-N,6-trimethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3,9-dicarboxamide.
| Compound Name | 9-N,9-N,6-trimethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3,9-dicarboxamide |
|---|---|
| PubChem CID | 54178618 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 9-N,9-N,6-trimethyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidine-3,9-dicarboxamide |
| SMILES | CC1CCC(C(=O)N(C)C)c2ncc(C(N)=O)c(=O)n21 |
| InChI | InChI=1S/C13H18N4O3/c1-7-4-5-8(12(19)16(2)3)11-15-6-9(10(14)18)13(20)17(7)11/h6-8H,4-5H2,1-3H3,(H2,14,18) |
| InChIKey | PAFAGTFASCDNGX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |