C10H13N5O2 — CID 57197527
9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 57197527) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 57197527 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 9-hydrazinylidene-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CC1CCC(=NN)c2ncc(C(N)=O)c(=O)n21 |
| InChI | InChI=1S/C10H13N5O2/c1-5-2-3-7(14-12)9-13-4-6(8(11)16)10(17)15(5)9/h4-5H,2-3,12H2,1H3,(H2,11,16) |
| InChIKey | XAJITVUQTCAQRH-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|