C11H18F3NO3S — CID 54179993
(2S)-4-methyl-2-[[(2R)-4,4,4-trifluoro-2-(sulfanylmethyl)butanoyl]amino]pentanoic acid (PubChem CID 54179993) has the molecular formula C11H18F3NO3S and a molecular weight of 301.33 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[(2R)-4,4,4-trifluoro-2-(sulfanylmethyl)butanoyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[(2R)-4,4,4-trifluoro-2-(sulfanylmethyl)butanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54179993 |
| Molecular Formula | C11H18F3NO3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2S)-4-methyl-2-[[(2R)-4,4,4-trifluoro-2-(sulfanylmethyl)butanoyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CS)CC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H18F3NO3S/c1-6(2)3-8(10(17)18)15-9(16)7(5-19)4-11(12,13)14/h6-8,19H,3-5H2,1-2H3,(H,15,16)(H,17,18)/t7-,8-/m0/s1 |
| InChIKey | PBCREQCLEXYXMW-YUMQZZPRSA-N |
| XLogP | 2.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|