C26H29NO5S — CID 54180315
4,4-bis(4-methoxyphenyl)-N-(2-methylphenoxy)sulfinylpentanamide (PubChem CID 54180315) has the molecular formula C26H29NO5S and a molecular weight of 467.59 g/mol. Its IUPAC name is 4,4-bis(4-methoxyphenyl)-N-(2-methylphenoxy)sulfinylpentanamide.
| Compound Name | 4,4-bis(4-methoxyphenyl)-N-(2-methylphenoxy)sulfinylpentanamide |
|---|---|
| PubChem CID | 54180315 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4,4-bis(4-methoxyphenyl)-N-(2-methylphenoxy)sulfinylpentanamide |
| SMILES | COc1ccc(C(C)(CCC(=O)NS(=O)Oc2ccccc2C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H29NO5S/c1-19-7-5-6-8-24(19)32-33(29)27-25(28)17-18-26(2,20-9-13-22(30-3)14-10-20)21-11-15-23(31-4)16-12-21/h5-16H,17-18H2,1-4H3,(H,27,28) |
| InChIKey | VERHZXKNUJHSFQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |