C20H16F3NO — CID 54181184
1,1,1-trifluoro-2,3-diphenyl-3-pyridin-2-ylpropan-2-ol (PubChem CID 54181184) has the molecular formula C20H16F3NO and a molecular weight of 343.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,3-diphenyl-3-pyridin-2-ylpropan-2-ol.
| Compound Name | 1,1,1-trifluoro-2,3-diphenyl-3-pyridin-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 54181184 |
| Molecular Formula | C20H16F3NO |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1,1,1-trifluoro-2,3-diphenyl-3-pyridin-2-ylpropan-2-ol |
| SMILES | OC(c1ccccc1)(C(c1ccccc1)c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO/c21-20(22,23)19(25,16-11-5-2-6-12-16)18(15-9-3-1-4-10-15)17-13-7-8-14-24-17/h1-14,18,25H |
| InChIKey | PBXIJVVUMPMRIF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |