C19H30O4 — CID 54186040
(4-ethylcyclohexyl) 4-but-2-enoyloxycyclohexane-1-carboxylate (PubChem CID 54186040) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is (4-ethylcyclohexyl) 4-but-2-enoyloxycyclohexane-1-carboxylate.
| Compound Name | (4-ethylcyclohexyl) 4-but-2-enoyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54186040 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (4-ethylcyclohexyl) 4-but-2-enoyloxycyclohexane-1-carboxylate |
| SMILES | CC=CC(=O)OC1CCC(C(=O)OC2CCC(CC)CC2)CC1 |
| InChI | InChI=1S/C19H30O4/c1-3-5-18(20)22-16-12-8-15(9-13-16)19(21)23-17-10-6-14(4-2)7-11-17/h3,5,14-17H,4,6-13H2,1-2H3 |
| InChIKey | PFEFSMVOHDNKCV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|