C32H39NO — CID 54186579
N-[3-(4aH-benzo[c][1]benzoxepin-6-ylidene)propyl]-4-(4-tert-butylphenyl)-N-methylbutan-1-amine (PubChem CID 54186579) has the molecular formula C32H39NO and a molecular weight of 453.67 g/mol. Its IUPAC name is N-[3-(4aH-benzo[c][1]benzoxepin-6-ylidene)propyl]-4-(4-tert-butylphenyl)-N-methylbutan-1-amine.
| Compound Name | N-[3-(4aH-benzo[c][1]benzoxepin-6-ylidene)propyl]-4-(4-tert-butylphenyl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 54186579 |
| Molecular Formula | C32H39NO |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | N-[3-(4aH-benzo[c][1]benzoxepin-6-ylidene)propyl]-4-(4-tert-butylphenyl)-N-methylbutan-1-amine |
| SMILES | CN(CCC=C1OC2C=CC=CC2=Cc2ccccc21)CCCCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H39NO/c1-32(2,3)28-20-18-25(19-21-28)12-9-10-22-33(4)23-11-17-31-29-15-7-5-13-26(29)24-27-14-6-8-16-30(27)34-31/h5-8,13-21,24,30H,9-12,22-23H2,1-4H3 |
| InChIKey | PFNBLDSKFQUQGG-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|