About (5S)-5,9-diamino-2-methylnonan-4-one
(5S)-5,9-diamino-2-methylnonan-4-one (PubChem CID 54186867) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is (5S)-5,9-diamino-2-methylnonan-4-one.
Molecular Properties
| Compound Name | (5S)-5,9-diamino-2-methylnonan-4-one |
| PubChem CID | 54186867 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | (5S)-5,9-diamino-2-methylnonan-4-one |
| SMILES | CC(C)CC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C10H22N2O/c1-8(2)7-10(13)9(12)5-3-4-6-11/h8-9H,3-7,11-12H2,1-2H3/t9-/m0/s1 |
| InChIKey | PFRWMLKMJILBNC-VIFPVBQESA-N |
| XLogP | 1.06 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5,9-diamino-2-methylnonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5,9-diamino-2-methylnonan-4-one?
The IUPAC name of (5S)-5,9-diamino-2-methylnonan-4-one (CID 54186867) is (5S)-5,9-diamino-2-methylnonan-4-one.
What is the SMILES notation for (5S)-5,9-diamino-2-methylnonan-4-one?
The canonical SMILES for (5S)-5,9-diamino-2-methylnonan-4-one is CC(C)CC(=O)[C@@H](N)CCCCN.
What is the InChIKey of (5S)-5,9-diamino-2-methylnonan-4-one?
The InChIKey is PFRWMLKMJILBNC-VIFPVBQESA-N. The full InChI is InChI=1S/C10H22N2O/c1-8(2)7-10(13)9(12)5-3-4-6-11/h8-9H,3-7,11-12H2,1-2H3/t9-/m0/s1.
What are the key properties of (5S)-5,9-diamino-2-methylnonan-4-one?
(5S)-5,9-diamino-2-methylnonan-4-one has a molecular weight of 186.30 g/mol, XLogP of 1.06, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5,9-diamino-2-methylnonan-4-one is sourced from PubChem (CID 54186867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).