C24H34N2O3S3 — CID 54190882
2-[4-(hexylsulfanylmethoxy)-3-methoxyphenyl]-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]acetamide (PubChem CID 54190882) has the molecular formula C24H34N2O3S3 and a molecular weight of 494.75 g/mol. Its IUPAC name is 2-[4-(hexylsulfanylmethoxy)-3-methoxyphenyl]-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]acetamide.
| Compound Name | 2-[4-(hexylsulfanylmethoxy)-3-methoxyphenyl]-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 54190882 |
| Molecular Formula | C24H34N2O3S3 |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 2-[4-(hexylsulfanylmethoxy)-3-methoxyphenyl]-N-[6-methyl-2,4-bis(methylsulfanyl)-3-pyridinyl]acetamide |
| SMILES | CCCCCCSCOc1ccc(CC(=O)Nc2c(SC)cc(C)nc2SC)cc1OC |
| InChI | InChI=1S/C24H34N2O3S3/c1-6-7-8-9-12-32-16-29-19-11-10-18(14-20(19)28-3)15-22(27)26-23-21(30-4)13-17(2)25-24(23)31-5/h10-11,13-14H,6-9,12,15-16H2,1-5H3,(H,26,27) |
| InChIKey | PIKQEMINLJPNQM-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|