C20H15N3O5 — CID 54190959
methyl 4-[(6-nitro-9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]benzoate (PubChem CID 54190959) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is methyl 4-[(6-nitro-9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]benzoate.
| Compound Name | methyl 4-[(6-nitro-9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 54190959 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | methyl 4-[(6-nitro-9-oxo-1,2-dihydropyrrolo[2,1-b]quinazolin-3-ylidene)methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2CCn3c2nc2cc([N+](=O)[O-])ccc2c3=O)cc1 |
| InChI | InChI=1S/C20H15N3O5/c1-28-20(25)13-4-2-12(3-5-13)10-14-8-9-22-18(14)21-17-11-15(23(26)27)6-7-16(17)19(22)24/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | PIMBRDWYZDWMOH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|