C20H16ClN3O5 — CID 135573698
(3E)-3-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 135573698) has the molecular formula C20H16ClN3O5 and a molecular weight of 413.82 g/mol. Its IUPAC name is (3E)-3-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
| Compound Name | (3E)-3-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 135573698 |
| Molecular Formula | C20H16ClN3O5 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (3E)-3-[(3-chloro-5-ethoxy-4-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | CCOc1cc(/C=C2\CCn3c2nc2ccc([N+](=O)[O-])cc2c3=O)cc(Cl)c1O |
| InChI | InChI=1S/C20H16ClN3O5/c1-2-29-17-9-11(8-15(21)18(17)25)7-12-5-6-23-19(12)22-16-4-3-13(24(27)28)10-14(16)20(23)26/h3-4,7-10,25H,2,5-6H2,1H3/b12-7+ |
| InChIKey | SFBLUEFYVLTEGL-KPKJPENVSA-N |
| XLogP | 4.01 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|