C19H12F3N3O3 — CID 8814443
(3Z)-7-nitro-3-[[3-(trifluoromethyl)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 8814443) has the molecular formula C19H12F3N3O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is (3Z)-7-nitro-3-[[3-(trifluoromethyl)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
| Compound Name | (3Z)-7-nitro-3-[[3-(trifluoromethyl)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 8814443 |
| Molecular Formula | C19H12F3N3O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | (3Z)-7-nitro-3-[[3-(trifluoromethyl)phenyl]methylidene]-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2nc2n1CC/C2=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H12F3N3O3/c20-19(21,22)13-3-1-2-11(9-13)8-12-6-7-24-17(12)23-16-5-4-14(25(27)28)10-15(16)18(24)26/h1-5,8-10H,6-7H2/b12-8- |
| InChIKey | JXCJYAVKGXKUPB-WQLSENKSSA-N |
| XLogP | 4.27 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|