C18H12BrN3O4 — CID 137314065
(3Z)-3-[(5-bromo-2-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one (PubChem CID 137314065) has the molecular formula C18H12BrN3O4 and a molecular weight of 414.22 g/mol. Its IUPAC name is (3Z)-3-[(5-bromo-2-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one.
| Compound Name | (3Z)-3-[(5-bromo-2-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 137314065 |
| Molecular Formula | C18H12BrN3O4 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | (3Z)-3-[(5-bromo-2-hydroxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2nc2n1CC/C2=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C18H12BrN3O4/c19-12-1-4-16(23)11(8-12)7-10-5-6-21-17(10)20-15-3-2-13(22(25)26)9-14(15)18(21)24/h1-4,7-9,23H,5-6H2/b10-7- |
| InChIKey | ALEJQTVDPXCXNZ-YFHOEESVSA-N |
| XLogP | 3.72 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|