C19H15BrClN3O9 — CID 25155514
(3E)-3-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one;perchloric acid (PubChem CID 25155514) has the molecular formula C19H15BrClN3O9 and a molecular weight of 544.70 g/mol. Its IUPAC name is (3E)-3-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one;perchloric acid.
| Compound Name | (3E)-3-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one;perchloric acid |
|---|---|
| PubChem CID | 25155514 |
| Molecular Formula | C19H15BrClN3O9 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 542.97 |
| IUPAC Name | (3E)-3-[(2-bromo-3-hydroxy-4-methoxyphenyl)methylidene]-7-nitro-1,2-dihydropyrrolo[2,1-b]quinazolin-9-one;perchloric acid |
| SMILES | COc1ccc(/C=C2\CCn3c2nc2ccc([N+](=O)[O-])cc2c3=O)c(Br)c1O.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C19H14BrN3O5.ClHO4/c1-28-15-5-2-10(16(20)17(15)24)8-11-6-7-22-18(11)21-14-4-3-12(23(26)27)9-13(14)19(22)25;2-1(3,4)5/h2-5,8-9,24H,6-7H2,1H3;(H,2,3,4,5)/b11-8+; |
| InChIKey | QPHNSPAOCUGTAH-YGCVIUNWSA-N |
| XLogP | -0.40 |
| TPSA | 196.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|