C11H8N4O4 — CID 919000
8-nitro-3,4-dihydro-1H-pyrimido[2,1-b]quinazoline-2,6-dione (PubChem CID 919000) has the molecular formula C11H8N4O4 and a molecular weight of 260.21 g/mol. Its IUPAC name is 8-nitro-3,4-dihydro-1H-pyrimido[2,1-b]quinazoline-2,6-dione.
| Compound Name | 8-nitro-3,4-dihydro-1H-pyrimido[2,1-b]quinazoline-2,6-dione |
|---|---|
| PubChem CID | 919000 |
| Molecular Formula | C11H8N4O4 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 8-nitro-3,4-dihydro-1H-pyrimido[2,1-b]quinazoline-2,6-dione |
| SMILES | O=C1CCn2c(nc3ccc([N+](=O)[O-])cc3c2=O)N1 |
| InChI | InChI=1S/C11H8N4O4/c16-9-3-4-14-10(17)7-5-6(15(18)19)1-2-8(7)12-11(14)13-9/h1-2,5H,3-4H2,(H,12,13,16) |
| InChIKey | GMVOZMBHJWQNBH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|