C17H13N3O3 — CID 7312400
(1R)-7-nitro-1-phenyl-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one (PubChem CID 7312400) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is (1R)-7-nitro-1-phenyl-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one.
| Compound Name | (1R)-7-nitro-1-phenyl-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| PubChem CID | 7312400 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (1R)-7-nitro-1-phenyl-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2nc2n1[C@@H](c1ccccc1)CC2 |
| InChI | InChI=1S/C17H13N3O3/c21-17-13-10-12(20(22)23)6-7-14(13)18-16-9-8-15(19(16)17)11-4-2-1-3-5-11/h1-7,10,15H,8-9H2/t15-/m1/s1 |
| InChIKey | KWLJZVKXUKGPQG-OAHLLOKOSA-N |
| XLogP | 2.84 |
| TPSA | 78.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|