C11H6N4O3 — CID 15548245
8-nitropyrimido[2,1-b]quinazolin-6-one (PubChem CID 15548245) has the molecular formula C11H6N4O3 and a molecular weight of 242.19 g/mol. Its IUPAC name is 8-nitropyrimido[2,1-b]quinazolin-6-one.
| Compound Name | 8-nitropyrimido[2,1-b]quinazolin-6-one |
|---|---|
| PubChem CID | 15548245 |
| Molecular Formula | C11H6N4O3 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 8-nitropyrimido[2,1-b]quinazolin-6-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2nc2ncccn12 |
| InChI | InChI=1S/C11H6N4O3/c16-10-8-6-7(15(17)18)2-3-9(8)13-11-12-4-1-5-14(10)11/h1-6H |
| InChIKey | PNUONYTXFCKULS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|