C15H20N2O2 — CID 541911
3-[[cyclohexyl(methyl)amino]methyl]-1,3-benzoxazol-2-one (PubChem CID 541911) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[[cyclohexyl(methyl)amino]methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[[cyclohexyl(methyl)amino]methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 541911 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 3-[[cyclohexyl(methyl)amino]methyl]-1,3-benzoxazol-2-one |
| SMILES | CN(Cn1c(=O)oc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C15H20N2O2/c1-16(12-7-3-2-4-8-12)11-17-13-9-5-6-10-14(13)19-15(17)18/h5-6,9-10,12H,2-4,7-8,11H2,1H3 |
| InChIKey | NRJCACVGUBPQBW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |