C10H13N5O4 — CID 54194811
N-(dimethylcarbamoyl)-3-(1-methyl-3-nitropyrazol-4-yl)prop-2-enamide (PubChem CID 54194811) has the molecular formula C10H13N5O4 and a molecular weight of 267.25 g/mol. Its IUPAC name is N-(dimethylcarbamoyl)-3-(1-methyl-3-nitropyrazol-4-yl)prop-2-enamide.
| Compound Name | N-(dimethylcarbamoyl)-3-(1-methyl-3-nitropyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 54194811 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N-(dimethylcarbamoyl)-3-(1-methyl-3-nitropyrazol-4-yl)prop-2-enamide |
| SMILES | CN(C)C(=O)NC(=O)C=Cc1cn(C)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N5O4/c1-13(2)10(17)11-8(16)5-4-7-6-14(3)12-9(7)15(18)19/h4-6H,1-3H3,(H,11,16,17) |
| InChIKey | PLBGVSWYQCWPCI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|