C14H18N6O3 — CID 19281888
(E)-3-(1-ethyl-5-methylpyrazol-4-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]prop-2-enamide (PubChem CID 19281888) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is (E)-3-(1-ethyl-5-methylpyrazol-4-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1-ethyl-5-methylpyrazol-4-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 19281888 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (E)-3-(1-ethyl-5-methylpyrazol-4-yl)-N-[2-(4-nitropyrazol-1-yl)ethyl]prop-2-enamide |
| SMILES | CCn1ncc(/C=C/C(=O)NCCn2cc([N+](=O)[O-])cn2)c1C |
| InChI | InChI=1S/C14H18N6O3/c1-3-19-11(2)12(8-17-19)4-5-14(21)15-6-7-18-10-13(9-16-18)20(22)23/h4-5,8-10H,3,6-7H2,1-2H3,(H,15,21)/b5-4+ |
| InChIKey | SCQAQFOYIZIHTD-SNAWJCMRSA-N |
| XLogP | 1.15 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|