C13H14S — CID 54195522
2-[(2,3-dimethylphenyl)methyl]thiophene (PubChem CID 54195522) has the molecular formula C13H14S and a molecular weight of 202.32 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)methyl]thiophene.
| Compound Name | 2-[(2,3-dimethylphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 54195522 |
| Molecular Formula | C13H14S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-[(2,3-dimethylphenyl)methyl]thiophene |
| SMILES | Cc1cccc(Cc2cccs2)c1C |
| InChI | InChI=1S/C13H14S/c1-10-5-3-6-12(11(10)2)9-13-7-4-8-14-13/h3-8H,9H2,1-2H3 |
| InChIKey | PLNNHXUMEQMNRO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |