C19H37NO5 — CID 54196012
2,3-dihydroxypropyl 3-[dodecanoyl(methyl)amino]propanoate (PubChem CID 54196012) has the molecular formula C19H37NO5 and a molecular weight of 359.51 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 3-[dodecanoyl(methyl)amino]propanoate.
| Compound Name | 2,3-dihydroxypropyl 3-[dodecanoyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 54196012 |
| Molecular Formula | C19H37NO5 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | 2,3-dihydroxypropyl 3-[dodecanoyl(methyl)amino]propanoate |
| SMILES | CCCCCCCCCCCC(=O)N(C)CCC(=O)OCC(O)CO |
| InChI | InChI=1S/C19H37NO5/c1-3-4-5-6-7-8-9-10-11-12-18(23)20(2)14-13-19(24)25-16-17(22)15-21/h17,21-22H,3-16H2,1-2H3 |
| InChIKey | PLVQXDCESDXRHP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|