C22H22O3 — CID 54198275
4-methyloct-4-en-1,7-diyn-3-yl 2-(1-benzofuran-2-yl)-3-methylbutanoate (PubChem CID 54198275) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-methyloct-4-en-1,7-diyn-3-yl 2-(1-benzofuran-2-yl)-3-methylbutanoate.
| Compound Name | 4-methyloct-4-en-1,7-diyn-3-yl 2-(1-benzofuran-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 54198275 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 4-methyloct-4-en-1,7-diyn-3-yl 2-(1-benzofuran-2-yl)-3-methylbutanoate |
| SMILES | C#CCC=C(C)C(C#C)OC(=O)C(c1cc2ccccc2o1)C(C)C |
| InChI | InChI=1S/C22H22O3/c1-6-8-11-16(5)18(7-2)25-22(23)21(15(3)4)20-14-17-12-9-10-13-19(17)24-20/h1-2,9-15,18,21H,8H2,3-5H3 |
| InChIKey | PNKDCHNDQLHEKA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|