C19H34O7 — CID 54199256
1-O-(2-hydroxybutyl) 3-O,5-O-dimethyl 1,1,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 54199256) has the molecular formula C19H34O7 and a molecular weight of 374.47 g/mol. Its IUPAC name is 1-O-(2-hydroxybutyl) 3-O,5-O-dimethyl 1,1,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2-hydroxybutyl) 3-O,5-O-dimethyl 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 54199256 |
| Molecular Formula | C19H34O7 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-O-(2-hydroxybutyl) 3-O,5-O-dimethyl 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(O)COC(=O)C(C)(C)CC(CC(C)(CC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C19H34O7/c1-8-14(20)12-26-16(22)18(3,4)10-13(15(21)24-6)11-19(5,9-2)17(23)25-7/h13-14,20H,8-12H2,1-7H3 |
| InChIKey | POASMVWYQXWWHU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|