C12H18O5 — CID 54199448
2-[4-(3-methoxy-5-oxocyclopenten-1-yl)butoxy]acetic acid (PubChem CID 54199448) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-[4-(3-methoxy-5-oxocyclopenten-1-yl)butoxy]acetic acid.
| Compound Name | 2-[4-(3-methoxy-5-oxocyclopenten-1-yl)butoxy]acetic acid |
|---|---|
| PubChem CID | 54199448 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[4-(3-methoxy-5-oxocyclopenten-1-yl)butoxy]acetic acid |
| SMILES | COC1C=C(CCCCOCC(=O)O)C(=O)C1 |
| InChI | InChI=1S/C12H18O5/c1-16-10-6-9(11(13)7-10)4-2-3-5-17-8-12(14)15/h6,10H,2-5,7-8H2,1H3,(H,14,15) |
| InChIKey | POEKKFQPBIVOEJ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|