C13H19FO4 — CID 54357235
2-fluoro-7-(3-methoxy-5-oxocyclopenten-1-yl)heptanoic acid (PubChem CID 54357235) has the molecular formula C13H19FO4 and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-fluoro-7-(3-methoxy-5-oxocyclopenten-1-yl)heptanoic acid.
| Compound Name | 2-fluoro-7-(3-methoxy-5-oxocyclopenten-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 54357235 |
| Molecular Formula | C13H19FO4 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-fluoro-7-(3-methoxy-5-oxocyclopenten-1-yl)heptanoic acid |
| SMILES | COC1C=C(CCCCCC(F)C(=O)O)C(=O)C1 |
| InChI | InChI=1S/C13H19FO4/c1-18-10-7-9(12(15)8-10)5-3-2-4-6-11(14)13(16)17/h7,10-11H,2-6,8H2,1H3,(H,16,17) |
| InChIKey | UJYQIWMRVPYSSB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|