C9H15NO5 — CID 54200972
1,2,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylic acid (PubChem CID 54200972) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1,2,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylic acid.
| Compound Name | 1,2,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylic acid |
|---|---|
| PubChem CID | 54200972 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1,2,8-trihydroxy-1,2,3,5,6,7,8,8a-octahydroindolizine-6-carboxylic acid |
| SMILES | O=C(O)C1CC(O)C2C(O)C(O)CN2C1 |
| InChI | InChI=1S/C9H15NO5/c11-5-1-4(9(14)15)2-10-3-6(12)8(13)7(5)10/h4-8,11-13H,1-3H2,(H,14,15) |
| InChIKey | PPFATSNAMQKHRY-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |