C12H22NO5+ — CID 59125267
ethyl (1S,2R,5S,8R,8aR)-1,2,8-trihydroxy-5-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-6-carboxylate (PubChem CID 59125267) has the molecular formula C12H22NO5+ and a molecular weight of 260.31 g/mol. Its IUPAC name is ethyl (1S,2R,5S,8R,8aR)-1,2,8-trihydroxy-5-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-6-carboxylate.
| Compound Name | ethyl (1S,2R,5S,8R,8aR)-1,2,8-trihydroxy-5-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-6-carboxylate |
|---|---|
| PubChem CID | 59125267 |
| Molecular Formula | C12H22NO5+ |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | ethyl (1S,2R,5S,8R,8aR)-1,2,8-trihydroxy-5-methyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-6-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H](O)[C@@H]2[C@H](O)[C@H](O)C[NH+]2[C@H]1C |
| InChI | InChI=1S/C12H21NO5/c1-3-18-12(17)7-4-8(14)10-11(16)9(15)5-13(10)6(7)2/h6-11,14-16H,3-5H2,1-2H3/p+1/t6-,7?,8+,9+,10+,11+/m0/s1 |
| InChIKey | HHQLXARWNYRPKW-QECKJRJWSA-O |
| XLogP | -2.69 |
| TPSA | 91.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |