C30H37N3O4 — CID 54201138
N-[4-[2-(diethylamino)ethyl]-3-[(2-ethoxybenzoyl)amino]phenyl]-2-ethoxybenzamide (PubChem CID 54201138) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-[4-[2-(diethylamino)ethyl]-3-[(2-ethoxybenzoyl)amino]phenyl]-2-ethoxybenzamide.
| Compound Name | N-[4-[2-(diethylamino)ethyl]-3-[(2-ethoxybenzoyl)amino]phenyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 54201138 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-[4-[2-(diethylamino)ethyl]-3-[(2-ethoxybenzoyl)amino]phenyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc(CCN(CC)CC)c(NC(=O)c2ccccc2OCC)c1 |
| InChI | InChI=1S/C30H37N3O4/c1-5-33(6-2)20-19-22-17-18-23(31-29(34)24-13-9-11-15-27(24)36-7-3)21-26(22)32-30(35)25-14-10-12-16-28(25)37-8-4/h9-18,21H,5-8,19-20H2,1-4H3,(H,31,34)(H,32,35) |
| InChIKey | PPIHLIYUSUDZPS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |