C26H29N7O2S — CID 54204365
N-[4-(1H-indazol-6-ylamino)quinazolin-6-yl]-4-(3-morpholin-4-ylpropylsulfanyl)but-2-enamide (PubChem CID 54204365) has the molecular formula C26H29N7O2S and a molecular weight of 503.63 g/mol. Its IUPAC name is N-[4-(1H-indazol-6-ylamino)quinazolin-6-yl]-4-(3-morpholin-4-ylpropylsulfanyl)but-2-enamide.
| Compound Name | N-[4-(1H-indazol-6-ylamino)quinazolin-6-yl]-4-(3-morpholin-4-ylpropylsulfanyl)but-2-enamide |
|---|---|
| PubChem CID | 54204365 |
| Molecular Formula | C26H29N7O2S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | N-[4-(1H-indazol-6-ylamino)quinazolin-6-yl]-4-(3-morpholin-4-ylpropylsulfanyl)but-2-enamide |
| SMILES | O=C(C=CCSCCCN1CCOCC1)Nc1ccc2ncnc(Nc3ccc4cn[nH]c4c3)c2c1 |
| InChI | InChI=1S/C26H29N7O2S/c34-25(3-1-13-36-14-2-8-33-9-11-35-12-10-33)30-20-6-7-23-22(15-20)26(28-18-27-23)31-21-5-4-19-17-29-32-24(19)16-21/h1,3-7,15-18H,2,8-14H2,(H,29,32)(H,30,34)(H,27,28,31) |
| InChIKey | PRLYQQPWSWFDIP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|