C26H26ClN3O5S — CID 54205947
4-[1-(5-amino-1H-indol-3-yl)ethyl]-N-[2-(2-chloroethoxy)phenyl]sulfonyl-3-methoxybenzamide (PubChem CID 54205947) has the molecular formula C26H26ClN3O5S and a molecular weight of 528.03 g/mol. Its IUPAC name is 4-[1-(5-amino-1H-indol-3-yl)ethyl]-N-[2-(2-chloroethoxy)phenyl]sulfonyl-3-methoxybenzamide.
| Compound Name | 4-[1-(5-amino-1H-indol-3-yl)ethyl]-N-[2-(2-chloroethoxy)phenyl]sulfonyl-3-methoxybenzamide |
|---|---|
| PubChem CID | 54205947 |
| Molecular Formula | C26H26ClN3O5S |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 4-[1-(5-amino-1H-indol-3-yl)ethyl]-N-[2-(2-chloroethoxy)phenyl]sulfonyl-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NS(=O)(=O)c2ccccc2OCCCl)ccc1C(C)c1c[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C26H26ClN3O5S/c1-16(21-15-29-22-10-8-18(28)14-20(21)22)19-9-7-17(13-24(19)34-2)26(31)30-36(32,33)25-6-4-3-5-23(25)35-12-11-27/h3-10,13-16,29H,11-12,28H2,1-2H3,(H,30,31) |
| InChIKey | PSMAZIMBXBLRET-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|