C33H39N3O5S — CID 54513346
4-[1-[5-[2-(butylamino)-2-oxoethyl]-1H-indol-3-yl]butyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide (PubChem CID 54513346) has the molecular formula C33H39N3O5S and a molecular weight of 589.76 g/mol. Its IUPAC name is 4-[1-[5-[2-(butylamino)-2-oxoethyl]-1H-indol-3-yl]butyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide.
| Compound Name | 4-[1-[5-[2-(butylamino)-2-oxoethyl]-1H-indol-3-yl]butyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 54513346 |
| Molecular Formula | C33H39N3O5S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 4-[1-[5-[2-(butylamino)-2-oxoethyl]-1H-indol-3-yl]butyl]-3-methoxy-N-(2-methylphenyl)sulfonylbenzamide |
| SMILES | CCCCNC(=O)Cc1ccc2[nH]cc(C(CCC)c3ccc(C(=O)NS(=O)(=O)c4ccccc4C)cc3OC)c2c1 |
| InChI | InChI=1S/C33H39N3O5S/c1-5-7-17-34-32(37)19-23-13-16-29-27(18-23)28(21-35-29)25(10-6-2)26-15-14-24(20-30(26)41-4)33(38)36-42(39,40)31-12-9-8-11-22(31)3/h8-9,11-16,18,20-21,25,35H,5-7,10,17,19H2,1-4H3,(H,34,37)(H,36,38) |
| InChIKey | YKRQFONOYJDBEF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|